2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid

C10H10N2O2S2 — CID 66972699

IUPAC2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid
SMILESO=S(O)CCc1nnc(-c2ccccc2)s1
InChIInChI=1S/C10H10N2O2S2/c13-16(14)7-6-9-11-12-10(15-9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,13,14)
InChIKeyVVWPUHGJHDPHTA-UHFFFAOYSA-N
MW254.34 g/mol
LogP1.97
Rot. Bonds4

About 2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid

2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid (PubChem CID 66972699) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid.

Molecular Properties

Compound Name2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid
PubChem CID66972699
Molecular FormulaC10H10N2O2S2
Molecular Weight254.34 g/mol
Exact Mass254.02
IUPAC Name2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid
SMILESO=S(O)CCc1nnc(-c2ccccc2)s1
InChIInChI=1S/C10H10N2O2S2/c13-16(14)7-6-9-11-12-10(15-9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,13,14)
InChIKeyVVWPUHGJHDPHTA-UHFFFAOYSA-N
XLogP1.97
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.34
LogP ≤ 51.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid?
The IUPAC name of 2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid (CID 66972699) is 2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid.
What is the SMILES notation for 2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid?
The canonical SMILES for 2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid is O=S(O)CCc1nnc(-c2ccccc2)s1.
What is the InChIKey of 2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid?
The InChIKey is VVWPUHGJHDPHTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S2/c13-16(14)7-6-9-11-12-10(15-9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,13,14).
What are the key properties of 2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid?
2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid has a molecular weight of 254.34 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid is sourced from PubChem (CID 66972699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).