C10H10N2O2S2 — CID 66972699
2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid (PubChem CID 66972699) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid.
| Compound Name | 2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid |
|---|---|
| PubChem CID | 66972699 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 2-(5-phenyl-1,3,4-thiadiazol-2-yl)ethanesulfinic acid |
| SMILES | O=S(O)CCc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C10H10N2O2S2/c13-16(14)7-6-9-11-12-10(15-9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,13,14) |
| InChIKey | VVWPUHGJHDPHTA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|