C12H23F2NOSSi — CID 66972796
N-[1-(cyclopropylmethylsulfanyl)-3-trimethylsilyloxypropan-2-yl]-2,2-difluoroethanimine (PubChem CID 66972796) has the molecular formula C12H23F2NOSSi and a molecular weight of 295.47 g/mol. Its IUPAC name is N-[1-(cyclopropylmethylsulfanyl)-3-trimethylsilyloxypropan-2-yl]-2,2-difluoroethanimine.
| Compound Name | N-[1-(cyclopropylmethylsulfanyl)-3-trimethylsilyloxypropan-2-yl]-2,2-difluoroethanimine |
|---|---|
| PubChem CID | 66972796 |
| Molecular Formula | C12H23F2NOSSi |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-[1-(cyclopropylmethylsulfanyl)-3-trimethylsilyloxypropan-2-yl]-2,2-difluoroethanimine |
| SMILES | C[Si](C)(C)OCC(CSCC1CC1)/N=C/C(F)F |
| InChI | InChI=1S/C12H23F2NOSSi/c1-18(2,3)16-7-11(15-6-12(13)14)9-17-8-10-4-5-10/h6,10-12H,4-5,7-9H2,1-3H3/b15-6+ |
| InChIKey | DPAYTQPNWMQYIE-GIDUJCDVSA-N |
| XLogP | 3.69 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|