C23H37NO4S — CID 146556705
(5E,7Z)-2-[1-amino-2-(cyclopropylmethylsulfanyl)ethyl]-6-(2-cyclopropylethoxy)-2-hydroxy-4-methylideneundeca-5,7-dienoic acid (PubChem CID 146556705) has the molecular formula C23H37NO4S and a molecular weight of 423.62 g/mol. Its IUPAC name is (5E,7Z)-2-[1-amino-2-(cyclopropylmethylsulfanyl)ethyl]-6-(2-cyclopropylethoxy)-2-hydroxy-4-methylideneundeca-5,7-dienoic acid.
| Compound Name | (5E,7Z)-2-[1-amino-2-(cyclopropylmethylsulfanyl)ethyl]-6-(2-cyclopropylethoxy)-2-hydroxy-4-methylideneundeca-5,7-dienoic acid |
|---|---|
| PubChem CID | 146556705 |
| Molecular Formula | C23H37NO4S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (5E,7Z)-2-[1-amino-2-(cyclopropylmethylsulfanyl)ethyl]-6-(2-cyclopropylethoxy)-2-hydroxy-4-methylideneundeca-5,7-dienoic acid |
| SMILES | C=C(/C=C(\C=C/CCC)OCCC1CC1)CC(O)(C(=O)O)C(N)CSCC1CC1 |
| InChI | InChI=1S/C23H37NO4S/c1-3-4-5-6-20(28-12-11-18-7-8-18)13-17(2)14-23(27,22(25)26)21(24)16-29-15-19-9-10-19/h5-6,13,18-19,21,27H,2-4,7-12,14-16,24H2,1H3,(H,25,26)/b6-5-,20-13+ |
| InChIKey | KMEPPKCOULNYBV-XQCGYQFLSA-N |
| XLogP | 4.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|