C41H68O5 — CID 145275859
2-[(1E,3E,5E,6E,7Z)-1-hydroxy-5-(3-methoxypropylidene)-6-(2-methylidenebutylidene)-11-[2-(4-pentylcyclohexyl)ethyl]pentadeca-1,3,7-trien-3-yl]oxyethyl acetate (PubChem CID 145275859) has the molecular formula C41H68O5 and a molecular weight of 640.99 g/mol. Its IUPAC name is 2-[(1E,3E,5E,6E,7Z)-1-hydroxy-5-(3-methoxypropylidene)-6-(2-methylidenebutylidene)-11-[2-(4-pentylcyclohexyl)ethyl]pentadeca-1,3,7-trien-3-yl]oxyethyl acetate.
| Compound Name | 2-[(1E,3E,5E,6E,7Z)-1-hydroxy-5-(3-methoxypropylidene)-6-(2-methylidenebutylidene)-11-[2-(4-pentylcyclohexyl)ethyl]pentadeca-1,3,7-trien-3-yl]oxyethyl acetate |
|---|---|
| PubChem CID | 145275859 |
| Molecular Formula | C41H68O5 |
| Molecular Weight | 640.99 g/mol |
| Exact Mass | 640.51 |
| IUPAC Name | 2-[(1E,3E,5E,6E,7Z)-1-hydroxy-5-(3-methoxypropylidene)-6-(2-methylidenebutylidene)-11-[2-(4-pentylcyclohexyl)ethyl]pentadeca-1,3,7-trien-3-yl]oxyethyl acetate |
| SMILES | C=C(/C=C(\C=C/CCC(CCCC)CCC1CCC(CCCCC)CC1)C(/C=C(\C=C\O)OCCOC(C)=O)=C/CCOC)CC |
| InChI | InChI=1S/C41H68O5/c1-7-10-12-17-37-22-25-38(26-23-37)24-21-36(16-11-8-2)18-13-14-19-39(32-34(4)9-3)40(20-15-29-44-6)33-41(27-28-42)46-31-30-45-35(5)43/h14,19-20,27-28,32-33,36-38,42H,4,7-13,15-18,21-26,29-31H2,1-3,5-6H3/b19-14-,28-27+,39-32+,40-20+,41-33+ |
| InChIKey | MVWYOEZNSDHYMK-YPPFWGLESA-N |
| XLogP | 11.69 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.99 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|