C6H10F2S — CID 130682739
2,2-difluoroethylsulfanylmethylcyclopropane (PubChem CID 130682739) has the molecular formula C6H10F2S and a molecular weight of 152.21 g/mol. Its IUPAC name is 2,2-difluoroethylsulfanylmethylcyclopropane.
| Compound Name | 2,2-difluoroethylsulfanylmethylcyclopropane |
|---|---|
| PubChem CID | 130682739 |
| Molecular Formula | C6H10F2S |
| Molecular Weight | 152.21 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 2,2-difluoroethylsulfanylmethylcyclopropane |
| SMILES | FC(F)CSCC1CC1 |
| InChI | InChI=1S/C6H10F2S/c7-6(8)4-9-3-5-1-2-5/h5-6H,1-4H2 |
| InChIKey | NOAFUVSAVOIUIF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |