C11H20O2S — CID 67930972
1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol (PubChem CID 67930972) has the molecular formula C11H20O2S and a molecular weight of 216.35 g/mol. Its IUPAC name is 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol.
| Compound Name | 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol |
|---|---|
| PubChem CID | 67930972 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol |
| SMILES | OC(CCSCC1CC1)C(O)C1CC1 |
| InChI | InChI=1S/C11H20O2S/c12-10(11(13)9-3-4-9)5-6-14-7-8-1-2-8/h8-13H,1-7H2 |
| InChIKey | HVDMBWAGQFKGIE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|