About 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol
1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol (PubChem CID 67930972) has the molecular formula C11H20O2S
and a molecular weight of 216.35 g/mol. Its IUPAC name is 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol.
Molecular Properties
| Compound Name | 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol |
| PubChem CID | 67930972 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol |
| SMILES | OC(CCSCC1CC1)C(O)C1CC1 |
| InChI | InChI=1S/C11H20O2S/c12-10(11(13)9-3-4-9)5-6-14-7-8-1-2-8/h8-13H,1-7H2 |
| InChIKey | HVDMBWAGQFKGIE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol?
The IUPAC name of 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol (CID 67930972) is 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol.
What is the SMILES notation for 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol?
The canonical SMILES for 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol is OC(CCSCC1CC1)C(O)C1CC1.
What is the InChIKey of 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol?
The InChIKey is HVDMBWAGQFKGIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2S/c12-10(11(13)9-3-4-9)5-6-14-7-8-1-2-8/h8-13H,1-7H2.
What are the key properties of 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol?
1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol has a molecular weight of 216.35 g/mol, XLogP of 1.65, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-4-(cyclopropylmethylsulfanyl)butane-1,2-diol is sourced from PubChem (CID 67930972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).