C13H25NO2 — CID 67852061
(1S,2R)-4-[(2S)-2-aminocyclohexyl]-1-cyclopropylbutane-1,2-diol (PubChem CID 67852061) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is (1S,2R)-4-[(2S)-2-aminocyclohexyl]-1-cyclopropylbutane-1,2-diol.
| Compound Name | (1S,2R)-4-[(2S)-2-aminocyclohexyl]-1-cyclopropylbutane-1,2-diol |
|---|---|
| PubChem CID | 67852061 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | (1S,2R)-4-[(2S)-2-aminocyclohexyl]-1-cyclopropylbutane-1,2-diol |
| SMILES | N[C@H]1CCCCC1CC[C@@H](O)[C@@H](O)C1CC1 |
| InChI | InChI=1S/C13H25NO2/c14-11-4-2-1-3-9(11)7-8-12(15)13(16)10-5-6-10/h9-13,15-16H,1-8,14H2/t9?,11-,12+,13-/m0/s1 |
| InChIKey | YQXLLRXYNQONQH-CTEVKTCYSA-N |
| XLogP | 1.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |