C27H48O6 — CID 70611379
2-[2,4-bis(4-cyclohexyl-3,4-dihydroxybutyl)cyclopentyl]acetic acid (PubChem CID 70611379) has the molecular formula C27H48O6 and a molecular weight of 468.68 g/mol. Its IUPAC name is 2-[2,4-bis(4-cyclohexyl-3,4-dihydroxybutyl)cyclopentyl]acetic acid.
| Compound Name | 2-[2,4-bis(4-cyclohexyl-3,4-dihydroxybutyl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70611379 |
| Molecular Formula | C27H48O6 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.35 |
| IUPAC Name | 2-[2,4-bis(4-cyclohexyl-3,4-dihydroxybutyl)cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1CC(CCC(O)C(O)C2CCCCC2)CC1CCC(O)C(O)C1CCCCC1 |
| InChI | InChI=1S/C27H48O6/c28-23(26(32)19-7-3-1-4-8-19)13-11-18-15-21(22(16-18)17-25(30)31)12-14-24(29)27(33)20-9-5-2-6-10-20/h18-24,26-29,32-33H,1-17H2,(H,30,31) |
| InChIKey | AWVNGZFSDAUTGV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |