C20H20O5 — CID 66973864
3-ethoxy-4-(2-ethoxyphenyl)-1-phenylbutane-1,2,4-trione (PubChem CID 66973864) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-ethoxy-4-(2-ethoxyphenyl)-1-phenylbutane-1,2,4-trione.
| Compound Name | 3-ethoxy-4-(2-ethoxyphenyl)-1-phenylbutane-1,2,4-trione |
|---|---|
| PubChem CID | 66973864 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 3-ethoxy-4-(2-ethoxyphenyl)-1-phenylbutane-1,2,4-trione |
| SMILES | CCOc1ccccc1C(=O)C(OCC)C(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20O5/c1-3-24-16-13-9-8-12-15(16)18(22)20(25-4-2)19(23)17(21)14-10-6-5-7-11-14/h5-13,20H,3-4H2,1-2H3 |
| InChIKey | POPGEICDCJETOA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|