C17H27NO3 — CID 66978129
N-[2-(2-hydroxypentyl)-3-methoxyphenyl]-2,2-dimethylpropanamide (PubChem CID 66978129) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-[2-(2-hydroxypentyl)-3-methoxyphenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-(2-hydroxypentyl)-3-methoxyphenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 66978129 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | N-[2-(2-hydroxypentyl)-3-methoxyphenyl]-2,2-dimethylpropanamide |
| SMILES | CCCC(O)Cc1c(NC(=O)C(C)(C)C)cccc1OC |
| InChI | InChI=1S/C17H27NO3/c1-6-8-12(19)11-13-14(9-7-10-15(13)21-5)18-16(20)17(2,3)4/h7,9-10,12,19H,6,8,11H2,1-5H3,(H,18,20) |
| InChIKey | VTHNZMIDBNZWRG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |