C15H18ClN3 — CID 66980467
5-(2-aminocyclopropyl)-N-(3-methylphenyl)pyridin-2-amine;hydrochloride (PubChem CID 66980467) has the molecular formula C15H18ClN3 and a molecular weight of 275.78 g/mol. Its IUPAC name is 5-(2-aminocyclopropyl)-N-(3-methylphenyl)pyridin-2-amine;hydrochloride.
| Compound Name | 5-(2-aminocyclopropyl)-N-(3-methylphenyl)pyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 66980467 |
| Molecular Formula | C15H18ClN3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 5-(2-aminocyclopropyl)-N-(3-methylphenyl)pyridin-2-amine;hydrochloride |
| SMILES | Cc1cccc(Nc2ccc(C3CC3N)cn2)c1.Cl |
| InChI | InChI=1S/C15H17N3.ClH/c1-10-3-2-4-12(7-10)18-15-6-5-11(9-17-15)13-8-14(13)16;/h2-7,9,13-14H,8,16H2,1H3,(H,17,18);1H |
| InChIKey | HGGMMEVGBKSSLO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |