C21H26N6O3 — CID 66988400
1-[4-[4-(3-hydroxyphenyl)-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazin-1-yl]but-2-en-1-one (PubChem CID 66988400) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is 1-[4-[4-(3-hydroxyphenyl)-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazin-1-yl]but-2-en-1-one.
| Compound Name | 1-[4-[4-(3-hydroxyphenyl)-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 66988400 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 1-[4-[4-(3-hydroxyphenyl)-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazin-1-yl]but-2-en-1-one |
| SMILES | CC=CC(=O)N1CCN(c2nc(-c3cccc(O)c3)nc(N3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C21H26N6O3/c1-2-4-18(29)25-7-9-26(10-8-25)20-22-19(16-5-3-6-17(28)15-16)23-21(24-20)27-11-13-30-14-12-27/h2-6,15,28H,7-14H2,1H3 |
| InChIKey | TWDLJVKRDDRWSR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|