About [1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride
[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride (PubChem CID 66989375) has the molecular formula C15H23Cl3N4S
and a molecular weight of 397.80 g/mol. Its IUPAC name is [1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride.
Molecular Properties
| Compound Name | [1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride |
| PubChem CID | 66989375 |
| Molecular Formula | C15H23Cl3N4S |
| Molecular Weight | 397.80 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | [1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride |
| SMILES | Cl.Cl.Cl.NCC1CCN(Cc2cnc(-c3ccccn3)s2)CC1 |
| InChI | InChI=1S/C15H20N4S.3ClH/c16-9-12-4-7-19(8-5-12)11-13-10-18-15(20-13)14-3-1-2-6-17-14;;;/h1-3,6,10,12H,4-5,7-9,11,16H2;3*1H |
| InChIKey | MRGPSUKPEQFCPL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride?
The IUPAC name of [1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride (CID 66989375) is [1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride.
What is the SMILES notation for [1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride?
The canonical SMILES for [1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride is Cl.Cl.Cl.NCC1CCN(Cc2cnc(-c3ccccn3)s2)CC1.
What is the InChIKey of [1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride?
The InChIKey is MRGPSUKPEQFCPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4S.3ClH/c16-9-12-4-7-19(8-5-12)11-13-10-18-15(20-13)14-3-1-2-6-17-14;;;/h1-3,6,10,12H,4-5,7-9,11,16H2;3*1H.
What are the key properties of [1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride?
[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride has a molecular weight of 397.80 g/mol, XLogP of 3.64, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine;trihydrochloride is sourced from PubChem (CID 66989375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).