About chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine
chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine (PubChem CID 159437389) has the molecular formula C16H23ClN4S
and a molecular weight of 338.91 g/mol. Its IUPAC name is chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine.
Molecular Properties
| Compound Name | chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine |
| PubChem CID | 159437389 |
| Molecular Formula | C16H23ClN4S |
| Molecular Weight | 338.91 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine |
| SMILES | CCl.NCC1CCN(Cc2cnc(-c3ccccn3)s2)CC1 |
| InChI | InChI=1S/C15H20N4S.CH3Cl/c16-9-12-4-7-19(8-5-12)11-13-10-18-15(20-13)14-3-1-2-6-17-14;1-2/h1-3,6,10,12H,4-5,7-9,11,16H2;1H3 |
| InChIKey | LRTBMUJLFGXXPM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.91 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine?
The IUPAC name of chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine (CID 159437389) is chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine.
What is the SMILES notation for chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine?
The canonical SMILES for chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine is CCl.NCC1CCN(Cc2cnc(-c3ccccn3)s2)CC1.
What is the InChIKey of chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine?
The InChIKey is LRTBMUJLFGXXPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4S.CH3Cl/c16-9-12-4-7-19(8-5-12)11-13-10-18-15(20-13)14-3-1-2-6-17-14;1-2/h1-3,6,10,12H,4-5,7-9,11,16H2;1H3.
What are the key properties of chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine?
chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine has a molecular weight of 338.91 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine is sourced from PubChem (CID 159437389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).