C16H23ClN4S — CID 159437389
chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine (PubChem CID 159437389) has the molecular formula C16H23ClN4S and a molecular weight of 338.91 g/mol. Its IUPAC name is chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine.
| Compound Name | chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 159437389 |
| Molecular Formula | C16H23ClN4S |
| Molecular Weight | 338.91 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | chloromethane;[1-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methyl]piperidin-4-yl]methanamine |
| SMILES | CCl.NCC1CCN(Cc2cnc(-c3ccccn3)s2)CC1 |
| InChI | InChI=1S/C15H20N4S.CH3Cl/c16-9-12-4-7-19(8-5-12)11-13-10-18-15(20-13)14-3-1-2-6-17-14;1-2/h1-3,6,10,12H,4-5,7-9,11,16H2;1H3 |
| InChIKey | LRTBMUJLFGXXPM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.91 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|