C21H28BN3O2S — CID 139014702
2-pyridin-2-yl-5-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-azabicyclo[4.1.0]heptan-3-yl]methyl]-1,3-thiazole (PubChem CID 139014702) has the molecular formula C21H28BN3O2S and a molecular weight of 397.35 g/mol. Its IUPAC name is 2-pyridin-2-yl-5-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-azabicyclo[4.1.0]heptan-3-yl]methyl]-1,3-thiazole.
| Compound Name | 2-pyridin-2-yl-5-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-azabicyclo[4.1.0]heptan-3-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 139014702 |
| Molecular Formula | C21H28BN3O2S |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 2-pyridin-2-yl-5-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-azabicyclo[4.1.0]heptan-3-yl]methyl]-1,3-thiazole |
| SMILES | CC1(C)OB(C23CCN(Cc4cnc(-c5ccccn5)s4)CC2C3)OC1(C)C |
| InChI | InChI=1S/C21H28BN3O2S/c1-19(2)20(3,4)27-22(26-19)21-8-10-25(13-15(21)11-21)14-16-12-24-18(28-16)17-7-5-6-9-23-17/h5-7,9,12,15H,8,10-11,13-14H2,1-4H3 |
| InChIKey | AENWDBGASTXHIN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|