C9H7N5S — CID 126697357
5-(azidomethyl)-2-pyridin-2-yl-1,3-thiazole (PubChem CID 126697357) has the molecular formula C9H7N5S and a molecular weight of 217.26 g/mol. Its IUPAC name is 5-(azidomethyl)-2-pyridin-2-yl-1,3-thiazole.
| Compound Name | 5-(azidomethyl)-2-pyridin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 126697357 |
| Molecular Formula | C9H7N5S |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 5-(azidomethyl)-2-pyridin-2-yl-1,3-thiazole |
| SMILES | [N-]=[N+]=NCc1cnc(-c2ccccn2)s1 |
| InChI | InChI=1S/C9H7N5S/c10-14-13-6-7-5-12-9(15-7)8-3-1-2-4-11-8/h1-5H,6H2 |
| InChIKey | AXKLNRPTMALUTB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 74.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|