C9H7KN2O2S — CID 131132164
potassium hydroxy-(2-pyridin-2-yl-1,3-thiazol-5-yl)methanolate (PubChem CID 131132164) has the molecular formula C9H7KN2O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is potassium hydroxy-(2-pyridin-2-yl-1,3-thiazol-5-yl)methanolate.
| Compound Name | potassium hydroxy-(2-pyridin-2-yl-1,3-thiazol-5-yl)methanolate |
|---|---|
| PubChem CID | 131132164 |
| Molecular Formula | C9H7KN2O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | potassium hydroxy-(2-pyridin-2-yl-1,3-thiazol-5-yl)methanolate |
| SMILES | [K+].[O-]C(O)c1cnc(-c2ccccn2)s1 |
| InChI | InChI=1S/C9H7N2O2S.K/c12-9(13)7-5-11-8(14-7)6-3-1-2-4-10-6;/h1-5,9,12H;/q-1;+1 |
| InChIKey | PUPKYAYCBMQLEI-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|