C9H5N3S — CID 82422608
2-pyridin-2-yl-1,3-thiazole-5-carbonitrile (PubChem CID 82422608) has the molecular formula C9H5N3S and a molecular weight of 187.23 g/mol. Its IUPAC name is 2-pyridin-2-yl-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-pyridin-2-yl-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 82422608 |
| Molecular Formula | C9H5N3S |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | 2-pyridin-2-yl-1,3-thiazole-5-carbonitrile |
| SMILES | N#Cc1cnc(-c2ccccn2)s1 |
| InChI | InChI=1S/C9H5N3S/c10-5-7-6-12-9(13-7)8-3-1-2-4-11-8/h1-4,6H |
| InChIKey | DCXNFXZUYMVBMU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |