C28H32N2O11 — CID 66990995
1-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]pyrrole-2,5-dione;2,3-dihydroxybutanedioic acid (PubChem CID 66990995) has the molecular formula C28H32N2O11 and a molecular weight of 572.57 g/mol. Its IUPAC name is 1-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]pyrrole-2,5-dione;2,3-dihydroxybutanedioic acid.
| Compound Name | 1-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]pyrrole-2,5-dione;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 66990995 |
| Molecular Formula | C28H32N2O11 |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | 1-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]pyrrole-2,5-dione;2,3-dihydroxybutanedioic acid |
| SMILES | O=C(O)C(O)C(O)C(=O)O.O=C1C=CC(=O)N1[C@@H]1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C24H26N2O5.C4H6O6/c27-16-4-3-14-11-17-24(30)8-7-15(26-18(28)5-6-19(26)29)22-23(24,20(14)21(16)31-22)9-10-25(17)12-13-1-2-13;5-1(3(7)8)2(6)4(9)10/h3-6,13,15,17,22,27,30H,1-2,7-12H2;1-2,5-6H,(H,7,8)(H,9,10)/t15-,17-,22+,23+,24-;/m1./s1 |
| InChIKey | AVYXDWDVZOYESK-BVBBZIGFSA-N |
| XLogP | -0.87 |
| TPSA | 205.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|