C36H34N2O5 — CID 69300180
1-[(4R,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3,4-diphenylpyrrole-2,5-dione (PubChem CID 69300180) has the molecular formula C36H34N2O5 and a molecular weight of 574.68 g/mol. Its IUPAC name is 1-[(4R,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3,4-diphenylpyrrole-2,5-dione.
| Compound Name | 1-[(4R,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3,4-diphenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 69300180 |
| Molecular Formula | C36H34N2O5 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 1-[(4R,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3,4-diphenylpyrrole-2,5-dione |
| SMILES | O=C1C(c2ccccc2)=C(c2ccccc2)C(=O)N1[C@@H]1CCC2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C36H34N2O5/c39-26-14-13-24-19-27-36(42)16-15-25(32-35(36,30(24)31(26)43-32)17-18-37(27)20-21-11-12-21)38-33(40)28(22-7-3-1-4-8-22)29(34(38)41)23-9-5-2-6-10-23/h1-10,13-14,21,25,27,32,39,42H,11-12,15-20H2/t25-,27-,32+,35+,36?/m1/s1 |
| InChIKey | PLDVVRHQJOWUFG-IYLQFNTCSA-N |
| XLogP | 4.30 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|