C29H30N2O5 — CID 69300365
2-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4-methylisoindole-1,3-dione (PubChem CID 69300365) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is 2-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4-methylisoindole-1,3-dione.
| Compound Name | 2-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 69300365 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 2-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4-methylisoindole-1,3-dione |
| SMILES | Cc1cccc2c1C(=O)N([C@@H]1CC[C@@]3(O)[C@H]4Cc5ccc(O)c6c5[C@@]3(CCN4CC3CC3)[C@H]1O6)C2=O |
| InChI | InChI=1S/C29H30N2O5/c1-15-3-2-4-18-22(15)27(34)31(26(18)33)19-9-10-29(35)21-13-17-7-8-20(32)24-23(17)28(29,25(19)36-24)11-12-30(21)14-16-5-6-16/h2-4,7-8,16,19,21,25,32,35H,5-6,9-14H2,1H3/t19-,21-,25+,28+,29-/m1/s1 |
| InChIKey | WBSZPRCCXLNRBY-RQYCADPMSA-N |
| XLogP | 2.93 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|