C28H27N3O7 — CID 58603797
2-[(4S,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-nitroisoindole-1,3-dione (PubChem CID 58603797) has the molecular formula C28H27N3O7 and a molecular weight of 517.54 g/mol. Its IUPAC name is 2-[(4S,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[(4S,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 58603797 |
| Molecular Formula | C28H27N3O7 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 2-[(4S,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-nitroisoindole-1,3-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1[C@@H]1CC[C@@]2(O)[C@@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C28H27N3O7/c32-20-6-3-15-11-21-28(35)8-7-19(30-25(33)17-5-4-16(31(36)37)12-18(17)26(30)34)24-27(28,22(15)23(20)38-24)9-10-29(21)13-14-1-2-14/h3-6,12,14,19,21,24,32,35H,1-2,7-11,13H2/t19-,21+,24+,27+,28-/m1/s1 |
| InChIKey | OTLWFWNMVOERIW-ZOQOPTIBSA-N |
| XLogP | 2.53 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|