C28H27ClN2O5 — CID 11679098
2-[(4R,4aS,7R,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-chloroisoindole-1,3-dione (PubChem CID 11679098) has the molecular formula C28H27ClN2O5 and a molecular weight of 506.99 g/mol. Its IUPAC name is 2-[(4R,4aS,7R,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-chloroisoindole-1,3-dione.
| Compound Name | 2-[(4R,4aS,7R,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-chloroisoindole-1,3-dione |
|---|---|
| PubChem CID | 11679098 |
| Molecular Formula | C28H27ClN2O5 |
| Molecular Weight | 506.99 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 2-[(4R,4aS,7R,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-chloroisoindole-1,3-dione |
| SMILES | O=C1c2ccc(Cl)cc2C(=O)N1[C@@H]1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@@H]1O5 |
| InChI | InChI=1S/C28H27ClN2O5/c29-16-4-5-17-18(12-16)26(34)31(25(17)33)19-7-8-28(35)21-11-15-3-6-20(32)23-22(15)27(28,24(19)36-23)9-10-30(21)13-14-1-2-14/h3-6,12,14,19,21,24,32,35H,1-2,7-11,13H2/t19-,21-,24-,27+,28-/m1/s1 |
| InChIKey | LBLWFQXNXAMUGD-VONKLZRQSA-N |
| XLogP | 3.27 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.99 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|