C29H31ClN2O5 — CID 11692156
2-[(4R,4aS,7R,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-methylisoindole-1,3-dione;hydrochloride (PubChem CID 11692156) has the molecular formula C29H31ClN2O5 and a molecular weight of 523.03 g/mol. Its IUPAC name is 2-[(4R,4aS,7R,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-methylisoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[(4R,4aS,7R,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-methylisoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 11692156 |
| Molecular Formula | C29H31ClN2O5 |
| Molecular Weight | 523.03 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 2-[(4R,4aS,7R,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-5-methylisoindole-1,3-dione;hydrochloride |
| SMILES | Cc1ccc2c(c1)C(=O)N([C@@H]1CC[C@@]3(O)[C@H]4Cc5ccc(O)c6c5[C@@]3(CCN4CC3CC3)[C@@H]1O6)C2=O.Cl |
| InChI | InChI=1S/C29H30N2O5.ClH/c1-15-2-6-18-19(12-15)27(34)31(26(18)33)20-8-9-29(35)22-13-17-5-7-21(32)24-23(17)28(29,25(20)36-24)10-11-30(22)14-16-3-4-16;/h2,5-7,12,16,20,22,25,32,35H,3-4,8-11,13-14H2,1H3;1H/t20-,22-,25-,28+,29-;/m1./s1 |
| InChIKey | VSJKMQCWJDEKHL-YRXAWZHTSA-N |
| XLogP | 3.35 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.03 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|