C20H28N2OS2 — CID 66994303
N-[[4-[dimethylamino(thiophen-2-yl)methyl]cyclohexyl]methyl]-2-thiophen-2-ylacetamide (PubChem CID 66994303) has the molecular formula C20H28N2OS2 and a molecular weight of 376.59 g/mol. Its IUPAC name is N-[[4-[dimethylamino(thiophen-2-yl)methyl]cyclohexyl]methyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[[4-[dimethylamino(thiophen-2-yl)methyl]cyclohexyl]methyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 66994303 |
| Molecular Formula | C20H28N2OS2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[[4-[dimethylamino(thiophen-2-yl)methyl]cyclohexyl]methyl]-2-thiophen-2-ylacetamide |
| SMILES | CN(C)C(c1cccs1)C1CCC(CNC(=O)Cc2cccs2)CC1 |
| InChI | InChI=1S/C20H28N2OS2/c1-22(2)20(18-6-4-12-25-18)16-9-7-15(8-10-16)14-21-19(23)13-17-5-3-11-24-17/h3-6,11-12,15-16,20H,7-10,13-14H2,1-2H3,(H,21,23) |
| InChIKey | JAPWTEXGJRLUSH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |