C22H29FN2OS — CID 66993904
N-[2-[4-[dimethylamino(thiophen-2-yl)methyl]cyclohexyl]ethyl]-4-fluorobenzamide (PubChem CID 66993904) has the molecular formula C22H29FN2OS and a molecular weight of 388.55 g/mol. Its IUPAC name is N-[2-[4-[dimethylamino(thiophen-2-yl)methyl]cyclohexyl]ethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[4-[dimethylamino(thiophen-2-yl)methyl]cyclohexyl]ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 66993904 |
| Molecular Formula | C22H29FN2OS |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-[2-[4-[dimethylamino(thiophen-2-yl)methyl]cyclohexyl]ethyl]-4-fluorobenzamide |
| SMILES | CN(C)C(c1cccs1)C1CCC(CCNC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H29FN2OS/c1-25(2)21(20-4-3-15-27-20)17-7-5-16(6-8-17)13-14-24-22(26)18-9-11-19(23)12-10-18/h3-4,9-12,15-17,21H,5-8,13-14H2,1-2H3,(H,24,26) |
| InChIKey | SDOLHFUXAXRGCC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |