C23H29N5O2 — CID 66995624
N-(4-methylcyclohexyl)-5-(2-methylindazol-6-yl)-4-[(3R)-oxolan-3-yl]oxypyrimidin-2-amine (PubChem CID 66995624) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-5-(2-methylindazol-6-yl)-4-[(3R)-oxolan-3-yl]oxypyrimidin-2-amine.
| Compound Name | N-(4-methylcyclohexyl)-5-(2-methylindazol-6-yl)-4-[(3R)-oxolan-3-yl]oxypyrimidin-2-amine |
|---|---|
| PubChem CID | 66995624 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | N-(4-methylcyclohexyl)-5-(2-methylindazol-6-yl)-4-[(3R)-oxolan-3-yl]oxypyrimidin-2-amine |
| SMILES | CC1CCC(Nc2ncc(-c3ccc4cn(C)nc4c3)c(O[C@@H]3CCOC3)n2)CC1 |
| InChI | InChI=1S/C23H29N5O2/c1-15-3-7-18(8-4-15)25-23-24-12-20(22(26-23)30-19-9-10-29-14-19)16-5-6-17-13-28(2)27-21(17)11-16/h5-6,11-13,15,18-19H,3-4,7-10,14H2,1-2H3,(H,24,25,26)/t15?,18?,19-/m1/s1 |
| InChIKey | RWDOIKNLTXEHKT-XUJQIHCRSA-N |
| XLogP | 4.19 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |