C19H26FN3O — CID 66997395
(2S,4R)-1-[(3aR,4S,6aS)-2-(3-methylphenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-fluoropyrrolidine-2-carboxamide (PubChem CID 66997395) has the molecular formula C19H26FN3O and a molecular weight of 331.43 g/mol. Its IUPAC name is (2S,4R)-1-[(3aR,4S,6aS)-2-(3-methylphenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(3aR,4S,6aS)-2-(3-methylphenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 66997395 |
| Molecular Formula | C19H26FN3O |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (2S,4R)-1-[(3aR,4S,6aS)-2-(3-methylphenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-fluoropyrrolidine-2-carboxamide |
| SMILES | Cc1cccc(N2C[C@H]3CC[C@H](N4C[C@H](F)C[C@H]4C(N)=O)[C@H]3C2)c1 |
| InChI | InChI=1S/C19H26FN3O/c1-12-3-2-4-15(7-12)22-9-13-5-6-17(16(13)11-22)23-10-14(20)8-18(23)19(21)24/h2-4,7,13-14,16-18H,5-6,8-11H2,1H3,(H2,21,24)/t13-,14-,16+,17+,18+/m1/s1 |
| InChIKey | FGVCWBGSFHAMTC-SSGTUYFUSA-N |
| XLogP | 2.11 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |