C21H11F3N2O4S — CID 67000175
3-(3,4-difluorophenyl)sulfonyl-4-(3-fluorophenyl)-7-nitroquinoline (PubChem CID 67000175) has the molecular formula C21H11F3N2O4S and a molecular weight of 444.39 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)sulfonyl-4-(3-fluorophenyl)-7-nitroquinoline.
| Compound Name | 3-(3,4-difluorophenyl)sulfonyl-4-(3-fluorophenyl)-7-nitroquinoline |
|---|---|
| PubChem CID | 67000175 |
| Molecular Formula | C21H11F3N2O4S |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | 3-(3,4-difluorophenyl)sulfonyl-4-(3-fluorophenyl)-7-nitroquinoline |
| SMILES | O=[N+]([O-])c1ccc2c(-c3cccc(F)c3)c(S(=O)(=O)c3ccc(F)c(F)c3)cnc2c1 |
| InChI | InChI=1S/C21H11F3N2O4S/c22-13-3-1-2-12(8-13)21-16-6-4-14(26(27)28)9-19(16)25-11-20(21)31(29,30)15-5-7-17(23)18(24)10-15/h1-11H |
| InChIKey | NIFMMLXNXMYDAX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 90.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|