C21H12F3NO2S — CID 91610952
2-(3,4-difluorophenyl)sulfonyl-4-(3-fluorophenyl)quinoline (PubChem CID 91610952) has the molecular formula C21H12F3NO2S and a molecular weight of 399.39 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfonyl-4-(3-fluorophenyl)quinoline.
| Compound Name | 2-(3,4-difluorophenyl)sulfonyl-4-(3-fluorophenyl)quinoline |
|---|---|
| PubChem CID | 91610952 |
| Molecular Formula | C21H12F3NO2S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfonyl-4-(3-fluorophenyl)quinoline |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)c1cc(-c2cccc(F)c2)c2ccccc2n1 |
| InChI | InChI=1S/C21H12F3NO2S/c22-14-5-3-4-13(10-14)17-12-21(25-20-7-2-1-6-16(17)20)28(26,27)15-8-9-18(23)19(24)11-15/h1-12H |
| InChIKey | QVOBOHGHZUKYCX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |