C26H25ClN4O3S2 — CID 67002720
1-[5-[5-chloro-1-(4-methylphenyl)sulfonyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrrolo[2,3-b]pyridin-4-yl]-1,3-thiazol-2-yl]cyclobutan-1-ol (PubChem CID 67002720) has the molecular formula C26H25ClN4O3S2 and a molecular weight of 541.10 g/mol. Its IUPAC name is 1-[5-[5-chloro-1-(4-methylphenyl)sulfonyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrrolo[2,3-b]pyridin-4-yl]-1,3-thiazol-2-yl]cyclobutan-1-ol.
| Compound Name | 1-[5-[5-chloro-1-(4-methylphenyl)sulfonyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrrolo[2,3-b]pyridin-4-yl]-1,3-thiazol-2-yl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 67002720 |
| Molecular Formula | C26H25ClN4O3S2 |
| Molecular Weight | 541.10 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | 1-[5-[5-chloro-1-(4-methylphenyl)sulfonyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrrolo[2,3-b]pyridin-4-yl]-1,3-thiazol-2-yl]cyclobutan-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)n2c(C3=CCNCC3)cc3c(-c4cnc(C5(O)CCC5)s4)c(Cl)cnc32)cc1 |
| InChI | InChI=1S/C26H25ClN4O3S2/c1-16-3-5-18(6-4-16)36(33,34)31-21(17-7-11-28-12-8-17)13-19-23(20(27)14-29-24(19)31)22-15-30-25(35-22)26(32)9-2-10-26/h3-7,13-15,28,32H,2,8-12H2,1H3 |
| InChIKey | GCAKCEKPKSOMBJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.10 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |