C26H24IN3O2S — CID 90054292
4-(iodomethyl)-1-(4-methylphenyl)sulfonyl-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]pyrrolo[2,3-b]pyridine (PubChem CID 90054292) has the molecular formula C26H24IN3O2S and a molecular weight of 569.47 g/mol. Its IUPAC name is 4-(iodomethyl)-1-(4-methylphenyl)sulfonyl-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]pyrrolo[2,3-b]pyridine.
| Compound Name | 4-(iodomethyl)-1-(4-methylphenyl)sulfonyl-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 90054292 |
| Molecular Formula | C26H24IN3O2S |
| Molecular Weight | 569.47 g/mol |
| Exact Mass | 569.06 |
| IUPAC Name | 4-(iodomethyl)-1-(4-methylphenyl)sulfonyl-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]pyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2c(-c3ccc(C4=CCNCC4)cc3)cc3c(CI)ccnc32)cc1 |
| InChI | InChI=1S/C26H24IN3O2S/c1-18-2-8-23(9-3-18)33(31,32)30-25(16-24-22(17-27)12-15-29-26(24)30)21-6-4-19(5-7-21)20-10-13-28-14-11-20/h2-10,12,15-16,28H,11,13-14,17H2,1H3 |
| InChIKey | VSGLEMNIOWZNNH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|