C26H48N2O4SSn — CID 67003644
tert-butyl 3-(methoxymethoxy)-3-(5-tributylstannyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 67003644) has the molecular formula C26H48N2O4SSn and a molecular weight of 603.46 g/mol. Its IUPAC name is tert-butyl 3-(methoxymethoxy)-3-(5-tributylstannyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(methoxymethoxy)-3-(5-tributylstannyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67003644 |
| Molecular Formula | C26H48N2O4SSn |
| Molecular Weight | 603.46 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | tert-butyl 3-(methoxymethoxy)-3-(5-tributylstannyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cnc(C2(OCOC)CCN(C(=O)OC(C)(C)C)C2)s1 |
| InChI | InChI=1S/C14H21N2O4S.3C4H9.Sn/c1-13(2,3)20-12(17)16-7-5-14(9-16,19-10-18-4)11-15-6-8-21-11;3*1-3-4-2;/h6H,5,7,9-10H2,1-4H3;3*1,3-4H2,2H3; |
| InChIKey | KUNRONSGCGZUPR-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.46 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|