C16H13N5O3 — CID 67009419
1-aminoethyl 2-(3-cyanophenoxy)-5H-pyrrolo[2,3-b]pyrazine-7-carboxylate (PubChem CID 67009419) has the molecular formula C16H13N5O3 and a molecular weight of 323.31 g/mol. Its IUPAC name is 1-aminoethyl 2-(3-cyanophenoxy)-5H-pyrrolo[2,3-b]pyrazine-7-carboxylate.
| Compound Name | 1-aminoethyl 2-(3-cyanophenoxy)-5H-pyrrolo[2,3-b]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 67009419 |
| Molecular Formula | C16H13N5O3 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 1-aminoethyl 2-(3-cyanophenoxy)-5H-pyrrolo[2,3-b]pyrazine-7-carboxylate |
| SMILES | CC(N)OC(=O)c1c[nH]c2ncc(Oc3cccc(C#N)c3)nc12 |
| InChI | InChI=1S/C16H13N5O3/c1-9(18)23-16(22)12-7-19-15-14(12)21-13(8-20-15)24-11-4-2-3-10(5-11)6-17/h2-5,7-9H,18H2,1H3,(H,19,20) |
| InChIKey | XXZAVNTZZZNPRQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|