C10H10O2 — CID 67010108
5a,9a-dihydro-2H-1-benzoxepin-5-one (PubChem CID 67010108) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is 5a,9a-dihydro-2H-1-benzoxepin-5-one.
| Compound Name | 5a,9a-dihydro-2H-1-benzoxepin-5-one |
|---|---|
| PubChem CID | 67010108 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 5a,9a-dihydro-2H-1-benzoxepin-5-one |
| SMILES | O=C1C=CCOC2C=CC=CC12 |
| InChI | InChI=1S/C10H10O2/c11-9-5-3-7-12-10-6-2-1-4-8(9)10/h1-6,8,10H,7H2 |
| InChIKey | AJTMJYIIGZTPMB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |