C11H13FO2 — CID 143570388
1-(4-fluoro-6-prop-2-enoxycyclohexa-2,4-dien-1-yl)ethanone (PubChem CID 143570388) has the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. Its IUPAC name is 1-(4-fluoro-6-prop-2-enoxycyclohexa-2,4-dien-1-yl)ethanone.
| Compound Name | 1-(4-fluoro-6-prop-2-enoxycyclohexa-2,4-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 143570388 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 1-(4-fluoro-6-prop-2-enoxycyclohexa-2,4-dien-1-yl)ethanone |
| SMILES | C=CCOC1C=C(F)C=CC1C(C)=O |
| InChI | InChI=1S/C11H13FO2/c1-3-6-14-11-7-9(12)4-5-10(11)8(2)13/h3-5,7,10-11H,1,6H2,2H3 |
| InChIKey | XOQLRPXNUFPNAH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|