C34H33N3O5 — CID 67010252
2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N-(4-phenoxyphenyl)-3-phenylmethoxypropanamide (PubChem CID 67010252) has the molecular formula C34H33N3O5 and a molecular weight of 563.65 g/mol. Its IUPAC name is 2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N-(4-phenoxyphenyl)-3-phenylmethoxypropanamide.
| Compound Name | 2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N-(4-phenoxyphenyl)-3-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 67010252 |
| Molecular Formula | C34H33N3O5 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | 2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N-(4-phenoxyphenyl)-3-phenylmethoxypropanamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)NC(COCc3ccccc3)C(=O)Nc3ccc(Oc4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C34H33N3O5/c1-23-29(30-19-28(40-2)17-18-31(30)35-23)20-33(38)37-32(22-41-21-24-9-5-3-6-10-24)34(39)36-25-13-15-27(16-14-25)42-26-11-7-4-8-12-26/h3-19,32,35H,20-22H2,1-2H3,(H,36,39)(H,37,38) |
| InChIKey | JYBHLUJZHZNPAQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|