C19H17ClO3S — CID 67011858
3-(4-chlorophenyl)-6-methyl-2-(4-methylsulfonylphenyl)-2H-pyran (PubChem CID 67011858) has the molecular formula C19H17ClO3S and a molecular weight of 360.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-6-methyl-2-(4-methylsulfonylphenyl)-2H-pyran.
| Compound Name | 3-(4-chlorophenyl)-6-methyl-2-(4-methylsulfonylphenyl)-2H-pyran |
|---|---|
| PubChem CID | 67011858 |
| Molecular Formula | C19H17ClO3S |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 3-(4-chlorophenyl)-6-methyl-2-(4-methylsulfonylphenyl)-2H-pyran |
| SMILES | CC1=CC=C(c2ccc(Cl)cc2)C(c2ccc(S(C)(=O)=O)cc2)O1 |
| InChI | InChI=1S/C19H17ClO3S/c1-13-3-12-18(14-4-8-16(20)9-5-14)19(23-13)15-6-10-17(11-7-15)24(2,21)22/h3-12,19H,1-2H3 |
| InChIKey | RFWLUVDOSQNIEU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |