C24H24N4O4 — CID 67013315
(1-methylpyrrol-3-yl) N-[4-[(E)-3-(6-morpholin-4-yl-2-pyridinyl)prop-2-enoyl]phenyl]carbamate (PubChem CID 67013315) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is (1-methylpyrrol-3-yl) N-[4-[(E)-3-(6-morpholin-4-yl-2-pyridinyl)prop-2-enoyl]phenyl]carbamate.
| Compound Name | (1-methylpyrrol-3-yl) N-[4-[(E)-3-(6-morpholin-4-yl-2-pyridinyl)prop-2-enoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 67013315 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (1-methylpyrrol-3-yl) N-[4-[(E)-3-(6-morpholin-4-yl-2-pyridinyl)prop-2-enoyl]phenyl]carbamate |
| SMILES | Cn1ccc(OC(=O)Nc2ccc(C(=O)/C=C/c3cccc(N4CCOCC4)n3)cc2)c1 |
| InChI | InChI=1S/C24H24N4O4/c1-27-12-11-21(17-27)32-24(30)26-20-7-5-18(6-8-20)22(29)10-9-19-3-2-4-23(25-19)28-13-15-31-16-14-28/h2-12,17H,13-16H2,1H3,(H,26,30)/b10-9+ |
| InChIKey | IAHPSBDHHXVOLL-MDZDMXLPSA-N |
| XLogP | 3.76 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|