C24H28N4O4 — CID 67013581
piperidin-4-yl N-[4-[3-(6-morpholin-4-yl-2-pyridinyl)prop-2-enoyl]phenyl]carbamate (PubChem CID 67013581) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is piperidin-4-yl N-[4-[3-(6-morpholin-4-yl-2-pyridinyl)prop-2-enoyl]phenyl]carbamate.
| Compound Name | piperidin-4-yl N-[4-[3-(6-morpholin-4-yl-2-pyridinyl)prop-2-enoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 67013581 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | piperidin-4-yl N-[4-[3-(6-morpholin-4-yl-2-pyridinyl)prop-2-enoyl]phenyl]carbamate |
| SMILES | O=C(Nc1ccc(C(=O)C=Cc2cccc(N3CCOCC3)n2)cc1)OC1CCNCC1 |
| InChI | InChI=1S/C24H28N4O4/c29-22(9-8-19-2-1-3-23(26-19)28-14-16-31-17-15-28)18-4-6-20(7-5-18)27-24(30)32-21-10-12-25-13-11-21/h1-9,21,25H,10-17H2,(H,27,30) |
| InChIKey | YCPGSYONJRCUBS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|