C26H25N7O2 — CID 67013532
1-[2-[amino-(6-methyl-2-pyridinyl)amino]ethyl]-3-[4-(3-quinoxalin-2-ylprop-2-enoyl)phenyl]urea (PubChem CID 67013532) has the molecular formula C26H25N7O2 and a molecular weight of 467.53 g/mol. Its IUPAC name is 1-[2-[amino-(6-methyl-2-pyridinyl)amino]ethyl]-3-[4-(3-quinoxalin-2-ylprop-2-enoyl)phenyl]urea.
| Compound Name | 1-[2-[amino-(6-methyl-2-pyridinyl)amino]ethyl]-3-[4-(3-quinoxalin-2-ylprop-2-enoyl)phenyl]urea |
|---|---|
| PubChem CID | 67013532 |
| Molecular Formula | C26H25N7O2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 1-[2-[amino-(6-methyl-2-pyridinyl)amino]ethyl]-3-[4-(3-quinoxalin-2-ylprop-2-enoyl)phenyl]urea |
| SMILES | Cc1cccc(N(N)CCNC(=O)Nc2ccc(C(=O)C=Cc3cnc4ccccc4n3)cc2)n1 |
| InChI | InChI=1S/C26H25N7O2/c1-18-5-4-8-25(30-18)33(27)16-15-28-26(35)32-20-11-9-19(10-12-20)24(34)14-13-21-17-29-22-6-2-3-7-23(22)31-21/h2-14,17H,15-16,27H2,1H3,(H2,28,32,35) |
| InChIKey | HGRHSFHZGZXLHG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|