C27H25N5O4S — CID 67013064
1-[2-[2-(benzenesulfonyl)hydrazinyl]ethyl]-3-[4-(3-quinolin-2-ylprop-2-enoyl)phenyl]urea (PubChem CID 67013064) has the molecular formula C27H25N5O4S and a molecular weight of 515.60 g/mol. Its IUPAC name is 1-[2-[2-(benzenesulfonyl)hydrazinyl]ethyl]-3-[4-(3-quinolin-2-ylprop-2-enoyl)phenyl]urea.
| Compound Name | 1-[2-[2-(benzenesulfonyl)hydrazinyl]ethyl]-3-[4-(3-quinolin-2-ylprop-2-enoyl)phenyl]urea |
|---|---|
| PubChem CID | 67013064 |
| Molecular Formula | C27H25N5O4S |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 1-[2-[2-(benzenesulfonyl)hydrazinyl]ethyl]-3-[4-(3-quinolin-2-ylprop-2-enoyl)phenyl]urea |
| SMILES | O=C(NCCNNS(=O)(=O)c1ccccc1)Nc1ccc(C(=O)C=Cc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C27H25N5O4S/c33-26(17-16-22-13-10-20-6-4-5-9-25(20)30-22)21-11-14-23(15-12-21)31-27(34)28-18-19-29-32-37(35,36)24-7-2-1-3-8-24/h1-17,29,32H,18-19H2,(H2,28,31,34) |
| InChIKey | WMEMYUIZSGWVCQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|