C14H10N2O3 — CID 67015291
(Z)-2-cyano-3-(3,5-dihydroxynaphthalen-2-yl)prop-2-enamide (PubChem CID 67015291) has the molecular formula C14H10N2O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,5-dihydroxynaphthalen-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,5-dihydroxynaphthalen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 67015291 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (Z)-2-cyano-3-(3,5-dihydroxynaphthalen-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cc2cccc(O)c2cc1O)C(N)=O |
| InChI | InChI=1S/C14H10N2O3/c15-7-10(14(16)19)5-9-4-8-2-1-3-12(17)11(8)6-13(9)18/h1-6,17-18H,(H2,16,19)/b10-5- |
| InChIKey | SDIMNFDFISBIFP-YHYXMXQVSA-N |
| XLogP | 1.64 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|