C10H6I2N2O2 — CID 54610321
(Z)-2-cyano-3-(2-hydroxy-3,5-diiodophenyl)prop-2-enamide (PubChem CID 54610321) has the molecular formula C10H6I2N2O2 and a molecular weight of 439.98 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-hydroxy-3,5-diiodophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-hydroxy-3,5-diiodophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 54610321 |
| Molecular Formula | C10H6I2N2O2 |
| Molecular Weight | 439.98 g/mol |
| Exact Mass | 439.85 |
| IUPAC Name | (Z)-2-cyano-3-(2-hydroxy-3,5-diiodophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cc(I)cc(I)c1O)C(N)=O |
| InChI | InChI=1S/C10H6I2N2O2/c11-7-2-5(9(15)8(12)3-7)1-6(4-13)10(14)16/h1-3,15H,(H2,14,16)/b6-1- |
| InChIKey | GBSHGOXFJKLHRU-BHQIHCQQSA-N |
| XLogP | 1.99 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.98 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|