C20H17BrIN3O2 — CID 124534171
(E)-3-(5-bromo-2-hydroxy-3-iodophenyl)-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 124534171) has the molecular formula C20H17BrIN3O2 and a molecular weight of 538.18 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-hydroxy-3-iodophenyl)-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(5-bromo-2-hydroxy-3-iodophenyl)-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 124534171 |
| Molecular Formula | C20H17BrIN3O2 |
| Molecular Weight | 538.18 g/mol |
| Exact Mass | 536.95 |
| IUPAC Name | (E)-3-(5-bromo-2-hydroxy-3-iodophenyl)-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Br)cc(I)c1O)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H17BrIN3O2/c21-16-11-14(19(26)18(22)12-16)10-15(13-23)20(27)25-8-6-24(7-9-25)17-4-2-1-3-5-17/h1-5,10-12,26H,6-9H2/b15-10+ |
| InChIKey | SNHYFZLFZZZDDN-XNTDXEJSSA-N |
| XLogP | 4.02 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.18 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|