C18H16ClN3OS — CID 1279987
(E)-3-(5-chlorothiophen-2-yl)-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 1279987) has the molecular formula C18H16ClN3OS and a molecular weight of 357.87 g/mol. Its IUPAC name is (E)-3-(5-chlorothiophen-2-yl)-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(5-chlorothiophen-2-yl)-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 1279987 |
| Molecular Formula | C18H16ClN3OS |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (E)-3-(5-chlorothiophen-2-yl)-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(Cl)s1)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H16ClN3OS/c19-17-7-6-16(24-17)12-14(13-20)18(23)22-10-8-21(9-11-22)15-4-2-1-3-5-15/h1-7,12H,8-11H2/b14-12+ |
| InChIKey | SVEUVWYUJDLSIZ-WYMLVPIESA-N |
| XLogP | 3.66 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|