(4-oxo-1H-quinolin-2-yl) hydrogen carbonate

C10H7NO4 — CID 67017481

IUPAC(4-oxo-1H-quinolin-2-yl) hydrogen carbonate
SMILESO=C(O)Oc1cc(=O)c2ccccc2[nH]1
InChIInChI=1S/C10H7NO4/c12-8-5-9(15-10(13)14)11-7-4-2-1-3-6(7)8/h1-5H,(H,11,12)(H,13,14)
InChIKeyWPDRHHCWEWOPMV-UHFFFAOYSA-N
MW205.17 g/mol
LogP1.58
Rot. Bonds1

About (4-oxo-1H-quinolin-2-yl) hydrogen carbonate

(4-oxo-1H-quinolin-2-yl) hydrogen carbonate (PubChem CID 67017481) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is (4-oxo-1H-quinolin-2-yl) hydrogen carbonate.

Molecular Properties

Compound Name(4-oxo-1H-quinolin-2-yl) hydrogen carbonate
PubChem CID67017481
Molecular FormulaC10H7NO4
Molecular Weight205.17 g/mol
Exact Mass205.04
IUPAC Name(4-oxo-1H-quinolin-2-yl) hydrogen carbonate
SMILESO=C(O)Oc1cc(=O)c2ccccc2[nH]1
InChIInChI=1S/C10H7NO4/c12-8-5-9(15-10(13)14)11-7-4-2-1-3-6(7)8/h1-5H,(H,11,12)(H,13,14)
InChIKeyWPDRHHCWEWOPMV-UHFFFAOYSA-N
XLogP1.58
TPSA79.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.17
LogP ≤ 51.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (4-oxo-1H-quinolin-2-yl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-oxo-1H-quinolin-2-yl) hydrogen carbonate?
The IUPAC name of (4-oxo-1H-quinolin-2-yl) hydrogen carbonate (CID 67017481) is (4-oxo-1H-quinolin-2-yl) hydrogen carbonate.
What is the SMILES notation for (4-oxo-1H-quinolin-2-yl) hydrogen carbonate?
The canonical SMILES for (4-oxo-1H-quinolin-2-yl) hydrogen carbonate is O=C(O)Oc1cc(=O)c2ccccc2[nH]1.
What is the InChIKey of (4-oxo-1H-quinolin-2-yl) hydrogen carbonate?
The InChIKey is WPDRHHCWEWOPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO4/c12-8-5-9(15-10(13)14)11-7-4-2-1-3-6(7)8/h1-5H,(H,11,12)(H,13,14).
What are the key properties of (4-oxo-1H-quinolin-2-yl) hydrogen carbonate?
(4-oxo-1H-quinolin-2-yl) hydrogen carbonate has a molecular weight of 205.17 g/mol, XLogP of 1.58, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-1H-quinolin-2-yl) hydrogen carbonate is sourced from PubChem (CID 67017481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).