C17H23NO2 — CID 67022585
(2S)-2-amino-2-cyclohexyl-2-(2,3-dihydro-1H-inden-2-yl)acetic acid (PubChem CID 67022585) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (2S)-2-amino-2-cyclohexyl-2-(2,3-dihydro-1H-inden-2-yl)acetic acid.
| Compound Name | (2S)-2-amino-2-cyclohexyl-2-(2,3-dihydro-1H-inden-2-yl)acetic acid |
|---|---|
| PubChem CID | 67022585 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (2S)-2-amino-2-cyclohexyl-2-(2,3-dihydro-1H-inden-2-yl)acetic acid |
| SMILES | N[C@@](C(=O)O)(C1CCCCC1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H23NO2/c18-17(16(19)20,14-8-2-1-3-9-14)15-10-12-6-4-5-7-13(12)11-15/h4-7,14-15H,1-3,8-11,18H2,(H,19,20)/t17-/m0/s1 |
| InChIKey | IBRBXMNSLWNMJA-KRWDZBQOSA-N |
| XLogP | 2.76 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |