C30H34O3 — CID 67022900
(8S,13S,14S,17S)-1-(4-acetylphenyl)-13-methyl-3'-methylidenespiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one (PubChem CID 67022900) has the molecular formula C30H34O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is (8S,13S,14S,17S)-1-(4-acetylphenyl)-13-methyl-3'-methylidenespiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one.
| Compound Name | (8S,13S,14S,17S)-1-(4-acetylphenyl)-13-methyl-3'-methylidenespiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one |
|---|---|
| PubChem CID | 67022900 |
| Molecular Formula | C30H34O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | (8S,13S,14S,17S)-1-(4-acetylphenyl)-13-methyl-3'-methylidenespiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one |
| SMILES | C=C1CCO[C@@]12CC[C@H]1[C@@H]3CCC4=CC(=O)CC(c5ccc(C(C)=O)cc5)C4=C3CC[C@@]12C |
| InChI | InChI=1S/C30H34O3/c1-18-12-15-33-30(18)14-11-27-24-9-8-22-16-23(32)17-26(21-6-4-20(5-7-21)19(2)31)28(22)25(24)10-13-29(27,30)3/h4-7,16,24,26-27H,1,8-15,17H2,2-3H3/t24-,26?,27+,29+,30+/m1/s1 |
| InChIKey | TWLDNYXKOHHHPB-CNPYCUCMSA-N |
| XLogP | 6.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|