C22H30O4 — CID 70189814
(1S,8S,13S,14S,17R)-1-hydroxy-17-(2-hydroxypropanoyl)-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70189814) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (1S,8S,13S,14S,17R)-1-hydroxy-17-(2-hydroxypropanoyl)-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (1S,8S,13S,14S,17R)-1-hydroxy-17-(2-hydroxypropanoyl)-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70189814 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (1S,8S,13S,14S,17R)-1-hydroxy-17-(2-hydroxypropanoyl)-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(O)C(=O)[C@]1(C)CC[C@H]2[C@@H]3CCC4=CC(=O)C[C@H](O)C4=C3CC[C@@]21C |
| InChI | InChI=1S/C22H30O4/c1-12(23)20(26)22(3)9-7-17-15-5-4-13-10-14(24)11-18(25)19(13)16(15)6-8-21(17,22)2/h10,12,15,17-18,23,25H,4-9,11H2,1-3H3/t12?,15-,17+,18+,21+,22+/m1/s1 |
| InChIKey | OSWDNHJBNAILOM-GTMARPNUSA-N |
| XLogP | 3.12 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |